C22H22N4OS2 — CID 6590973
1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea (PubChem CID 6590973) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 6590973 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)N[C@H]1C[C@H]2CC[C@@H]1C2)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C22H22N4OS2/c27-21(25-26-22(28)24-18-11-13-7-8-14(18)10-13)16-12-19(20-6-3-9-29-20)23-17-5-2-1-4-15(16)17/h1-6,9,12-14,18H,7-8,10-11H2,(H,25,27)(H2,24,26,28)/t13-,14+,18-/m0/s1 |
| InChIKey | HBJGPBCIRSYKCQ-IYOUNJFTSA-N |
| XLogP | 4.26 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|