C20H20N4O2S2 — CID 17375034
1-(oxolan-2-ylmethyl)-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea (PubChem CID 17375034) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 17375034 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)NCC1CCCO1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H20N4O2S2/c25-19(23-24-20(27)21-12-13-5-3-9-26-13)15-11-17(18-8-4-10-28-18)22-16-7-2-1-6-14(15)16/h1-2,4,6-8,10-11,13H,3,5,9,12H2,(H,23,25)(H2,21,24,27) |
| InChIKey | PPRUFHDVUWEXNL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|