C19H17NO3S — CID 94829407
[(2S)-oxolan-2-yl]methyl 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 94829407) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 94829407 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | O=C(OC[C@@H]1CCCO1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C19H17NO3S/c21-19(23-12-13-5-3-9-22-13)15-11-17(18-8-4-10-24-18)20-16-7-2-1-6-14(15)16/h1-2,4,6-8,10-11,13H,3,5,9,12H2/t13-/m0/s1 |
| InChIKey | JHLDSQLYXQJRPE-ZDUSSCGKSA-N |
| XLogP | 4.30 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |