C19H21Cl2N3OS — CID 119509830
N-(pyrrolidin-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride (PubChem CID 119509830) has the molecular formula C19H21Cl2N3OS and a molecular weight of 410.37 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride.
| Compound Name | N-(pyrrolidin-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119509830 |
| Molecular Formula | C19H21Cl2N3OS |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC1CCCN1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C19H19N3OS.2ClH/c23-19(21-12-13-5-3-9-20-13)15-11-17(18-8-4-10-24-18)22-16-7-2-1-6-14(15)16;;/h1-2,4,6-8,10-11,13,20H,3,5,9,12H2,(H,21,23);2*1H |
| InChIKey | IUPOJYRGPVKYHA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |