C20H16N3OS+ — CID 4164269
N-(pyridin-1-ium-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 4164269) has the molecular formula C20H16N3OS+ and a molecular weight of 346.44 g/mol. Its IUPAC name is N-(pyridin-1-ium-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(pyridin-1-ium-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4164269 |
| Molecular Formula | C20H16N3OS+ |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(pyridin-1-ium-2-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NCc1cccc[nH+]1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H15N3OS/c24-20(22-13-14-6-3-4-10-21-14)16-12-18(19-9-5-11-25-19)23-17-8-2-1-7-15(16)17/h1-12H,13H2,(H,22,24)/p+1 |
| InChIKey | OAGRGRVCUAYVJO-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |