C18H18N2OS — CID 4247339
N,N-diethyl-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 4247339) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is N,N-diethyl-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N,N-diethyl-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4247339 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N,N-diethyl-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C18H18N2OS/c1-3-20(4-2)18(21)14-12-16(17-10-7-11-22-17)19-15-9-6-5-8-13(14)15/h5-12H,3-4H2,1-2H3 |
| InChIKey | DBWOJKSBUJWNAK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |