C24H31N3OS — CID 15987887
N-[2-[bis(2-methylpropyl)amino]ethyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 15987887) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is N-[2-[bis(2-methylpropyl)amino]ethyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[2-[bis(2-methylpropyl)amino]ethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 15987887 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[2-[bis(2-methylpropyl)amino]ethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | CC(C)CN(CCNC(=O)c1cc(-c2cccs2)nc2ccccc12)CC(C)C |
| InChI | InChI=1S/C24H31N3OS/c1-17(2)15-27(16-18(3)4)12-11-25-24(28)20-14-22(23-10-7-13-29-23)26-21-9-6-5-8-19(20)21/h5-10,13-14,17-18H,11-12,15-16H2,1-4H3,(H,25,28) |
| InChIKey | YEFHPOIFBLKTBF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |