C25H32N4O — CID 4302865
N-[2-[bis(2-methylpropyl)amino]ethyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 4302865) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[2-[bis(2-methylpropyl)amino]ethyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[2-[bis(2-methylpropyl)amino]ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4302865 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N-[2-[bis(2-methylpropyl)amino]ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | CC(C)CN(CCNC(=O)c1cc(-c2ccncc2)nc2ccccc12)CC(C)C |
| InChI | InChI=1S/C25H32N4O/c1-18(2)16-29(17-19(3)4)14-13-27-25(30)22-15-24(20-9-11-26-12-10-20)28-23-8-6-5-7-21(22)23/h5-12,15,18-19H,13-14,16-17H2,1-4H3,(H,27,30) |
| InChIKey | KAZPASFHYNBVRL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |