C20H20N4O2 — CID 41492842
N-[2-oxo-2-(propylamino)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 41492842) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[2-oxo-2-(propylamino)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[2-oxo-2-(propylamino)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 41492842 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[2-oxo-2-(propylamino)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | CCCNC(=O)CNC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C20H20N4O2/c1-2-9-22-19(25)13-23-20(26)16-12-18(14-7-10-21-11-8-14)24-17-6-4-3-5-15(16)17/h3-8,10-12H,2,9,13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | DAXLBXCTERRILW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |