C20H23Cl2N3OS — CID 119459873
N-(piperidin-3-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride (PubChem CID 119459873) has the molecular formula C20H23Cl2N3OS and a molecular weight of 424.40 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride.
| Compound Name | N-(piperidin-3-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119459873 |
| Molecular Formula | C20H23Cl2N3OS |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-2-thiophen-2-ylquinoline-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC1CCCNC1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H21N3OS.2ClH/c24-20(22-13-14-5-3-9-21-12-14)16-11-18(19-8-4-10-25-19)23-17-7-2-1-6-15(16)17;;/h1-2,4,6-8,10-11,14,21H,3,5,9,12-13H2,(H,22,24);2*1H |
| InChIKey | CYPWWQQKGOFUPT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |