C22H26Cl2N4O — CID 119557872
N-(2-piperidin-3-ylethyl)-2-pyridin-3-ylquinoline-4-carboxamide;dihydrochloride (PubChem CID 119557872) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is N-(2-piperidin-3-ylethyl)-2-pyridin-3-ylquinoline-4-carboxamide;dihydrochloride.
| Compound Name | N-(2-piperidin-3-ylethyl)-2-pyridin-3-ylquinoline-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119557872 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(2-piperidin-3-ylethyl)-2-pyridin-3-ylquinoline-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCC1CCCNC1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C22H24N4O.2ClH/c27-22(25-12-9-16-5-3-10-23-14-16)19-13-21(17-6-4-11-24-15-17)26-20-8-2-1-7-18(19)20;;/h1-2,4,6-8,11,13,15-16,23H,3,5,9-10,12,14H2,(H,25,27);2*1H |
| InChIKey | MVSFPKUXEMAGTD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |