C20H19N3O — CID 162460260
N-(azetidin-3-ylmethyl)-2-phenylquinoline-4-carboxamide (PubChem CID 162460260) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(azetidin-3-ylmethyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 162460260 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(NCC1CNC1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C20H19N3O/c24-20(22-13-14-11-21-12-14)17-10-19(15-6-2-1-3-7-15)23-18-9-5-4-8-16(17)18/h1-10,14,21H,11-13H2,(H,22,24) |
| InChIKey | XFSSKPNPCJVSIV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |