C24H26N4O3 — CID 69025406
[4-[[(2-pyridin-4-ylquinoline-4-carbonyl)amino]methyl]cyclohexyl]methylcarbamic acid (PubChem CID 69025406) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [4-[[(2-pyridin-4-ylquinoline-4-carbonyl)amino]methyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [4-[[(2-pyridin-4-ylquinoline-4-carbonyl)amino]methyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 69025406 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [4-[[(2-pyridin-4-ylquinoline-4-carbonyl)amino]methyl]cyclohexyl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CCC(CNC(=O)c2cc(-c3ccncc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H26N4O3/c29-23(26-14-16-5-7-17(8-6-16)15-27-24(30)31)20-13-22(18-9-11-25-12-10-18)28-21-4-2-1-3-19(20)21/h1-4,9-13,16-17,27H,5-8,14-15H2,(H,26,29)(H,30,31) |
| InChIKey | XLNVWAFSNFVMGN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |