C27H33N5O4 — CID 69029071
[4-[[[2-[6-(2-methoxyethylamino)-3-pyridinyl]quinoline-4-carbonyl]amino]methyl]cyclohexyl]methylcarbamic acid (PubChem CID 69029071) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is [4-[[[2-[6-(2-methoxyethylamino)-3-pyridinyl]quinoline-4-carbonyl]amino]methyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [4-[[[2-[6-(2-methoxyethylamino)-3-pyridinyl]quinoline-4-carbonyl]amino]methyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 69029071 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [4-[[[2-[6-(2-methoxyethylamino)-3-pyridinyl]quinoline-4-carbonyl]amino]methyl]cyclohexyl]methylcarbamic acid |
| SMILES | COCCNc1ccc(-c2cc(C(=O)NCC3CCC(CNC(=O)O)CC3)c3ccccc3n2)cn1 |
| InChI | InChI=1S/C27H33N5O4/c1-36-13-12-28-25-11-10-20(17-29-25)24-14-22(21-4-2-3-5-23(21)32-24)26(33)30-15-18-6-8-19(9-7-18)16-31-27(34)35/h2-5,10-11,14,17-19,31H,6-9,12-13,15-16H2,1H3,(H,28,29)(H,30,33)(H,34,35) |
| InChIKey | SDAOUUFOELFNIX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|