C28H33FN4O3 — CID 68877107
tert-butyl-[[4-[[[2-(6-fluoro-3-pyridinyl)quinoline-4-carbonyl]amino]methyl]cyclohexyl]methyl]carbamic acid (PubChem CID 68877107) has the molecular formula C28H33FN4O3 and a molecular weight of 492.60 g/mol. Its IUPAC name is tert-butyl-[[4-[[[2-(6-fluoro-3-pyridinyl)quinoline-4-carbonyl]amino]methyl]cyclohexyl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[4-[[[2-(6-fluoro-3-pyridinyl)quinoline-4-carbonyl]amino]methyl]cyclohexyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 68877107 |
| Molecular Formula | C28H33FN4O3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | tert-butyl-[[4-[[[2-(6-fluoro-3-pyridinyl)quinoline-4-carbonyl]amino]methyl]cyclohexyl]methyl]carbamic acid |
| SMILES | CC(C)(C)N(CC1CCC(CNC(=O)c2cc(-c3ccc(F)nc3)nc3ccccc23)CC1)C(=O)O |
| InChI | InChI=1S/C28H33FN4O3/c1-28(2,3)33(27(35)36)17-19-10-8-18(9-11-19)15-31-26(34)22-14-24(20-12-13-25(29)30-16-20)32-23-7-5-4-6-21(22)23/h4-7,12-14,16,18-19H,8-11,15,17H2,1-3H3,(H,31,34)(H,35,36) |
| InChIKey | LWECPUYJWLQOQM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|