C20H19N3O2S — CID 55812409
N-(2-oxoazepan-3-yl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 55812409) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(2-oxoazepan-3-yl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55812409 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H19N3O2S/c24-19(23-16-8-3-4-10-21-20(16)25)14-12-17(18-9-5-11-26-18)22-15-7-2-1-6-13(14)15/h1-2,5-7,9,11-12,16H,3-4,8,10H2,(H,21,25)(H,23,24) |
| InChIKey | QPSNGRPADJVSAV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |