C21H21N3OS — CID 2327036
N'-(cyclohepten-1-yl)-2-thiophen-2-ylquinoline-4-carbohydrazide (PubChem CID 2327036) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is N'-(cyclohepten-1-yl)-2-thiophen-2-ylquinoline-4-carbohydrazide.
| Compound Name | N'-(cyclohepten-1-yl)-2-thiophen-2-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 2327036 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N'-(cyclohepten-1-yl)-2-thiophen-2-ylquinoline-4-carbohydrazide |
| SMILES | O=C(NNC1=CCCCCC1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C21H21N3OS/c25-21(24-23-15-8-3-1-2-4-9-15)17-14-19(20-12-7-13-26-20)22-18-11-6-5-10-16(17)18/h5-8,10-14,23H,1-4,9H2,(H,24,25) |
| InChIKey | ZMTNGKDSFXJTNK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|