C21H18FN3O — CID 2318990
N'-(cyclopenten-1-yl)-2-(4-fluorophenyl)quinoline-4-carbohydrazide (PubChem CID 2318990) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is N'-(cyclopenten-1-yl)-2-(4-fluorophenyl)quinoline-4-carbohydrazide.
| Compound Name | N'-(cyclopenten-1-yl)-2-(4-fluorophenyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 2318990 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N'-(cyclopenten-1-yl)-2-(4-fluorophenyl)quinoline-4-carbohydrazide |
| SMILES | O=C(NNC1=CCCC1)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H18FN3O/c22-15-11-9-14(10-12-15)20-13-18(17-7-3-4-8-19(17)23-20)21(26)25-24-16-5-1-2-6-16/h3-5,7-13,24H,1-2,6H2,(H,25,26) |
| InChIKey | ZAUQXVUWIZTHPG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|