C14H15Cl2NO — CID 7241697
N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2,6-dichlorobenzamide (PubChem CID 7241697) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2,6-dichlorobenzamide.
| Compound Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 7241697 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2,6-dichlorobenzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@H]1C2)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H15Cl2NO/c15-10-2-1-3-11(16)13(10)14(18)17-12-7-8-4-5-9(12)6-8/h1-3,8-9,12H,4-7H2,(H,17,18)/t8-,9-,12-/m0/s1 |
| InChIKey | OTDGJRIHNWDMMQ-AUTRQRHGSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |