C15H18ClNO — CID 100631226
N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(2-chlorophenyl)acetamide (PubChem CID 100631226) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 100631226 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(2-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1Cl)N[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C15H18ClNO/c16-13-4-2-1-3-11(13)9-15(18)17-14-8-10-5-6-12(14)7-10/h1-4,10,12,14H,5-9H2,(H,17,18)/t10-,12-,14-/m1/s1 |
| InChIKey | YZTPRVQANHRYST-MPKXVKKWSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |