C13H15BrClNO — CID 80662926
N-(2-bromocyclopentyl)-2-(2-chlorophenyl)acetamide (PubChem CID 80662926) has the molecular formula C13H15BrClNO and a molecular weight of 316.63 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-2-(2-chlorophenyl)acetamide.
| Compound Name | N-(2-bromocyclopentyl)-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 80662926 |
| Molecular Formula | C13H15BrClNO |
| Molecular Weight | 316.63 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | N-(2-bromocyclopentyl)-2-(2-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1Cl)NC1CCCC1Br |
| InChI | InChI=1S/C13H15BrClNO/c14-10-5-3-7-12(10)16-13(17)8-9-4-1-2-6-11(9)15/h1-2,4,6,10,12H,3,5,7-8H2,(H,16,17) |
| InChIKey | PLOAVEIHFKKTTM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|