C17H24ClN3O2 — CID 23761302
N-[2-[(2-chlorophenyl)methylcarbamoylamino]cyclohexyl]propanamide (PubChem CID 23761302) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylcarbamoylamino]cyclohexyl]propanamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylcarbamoylamino]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 23761302 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylcarbamoylamino]cyclohexyl]propanamide |
| SMILES | CCC(=O)NC1CCCCC1NC(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H24ClN3O2/c1-2-16(22)20-14-9-5-6-10-15(14)21-17(23)19-11-12-7-3-4-8-13(12)18/h3-4,7-8,14-15H,2,5-6,9-11H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | IUKXCDQAYKZIKZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |