C17H26N2O2 — CID 111631134
1-[(2-ethylphenyl)methyl]-3-[2-(hydroxymethyl)cyclohexyl]urea (PubChem CID 111631134) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[(2-ethylphenyl)methyl]-3-[2-(hydroxymethyl)cyclohexyl]urea.
| Compound Name | 1-[(2-ethylphenyl)methyl]-3-[2-(hydroxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 111631134 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-[(2-ethylphenyl)methyl]-3-[2-(hydroxymethyl)cyclohexyl]urea |
| SMILES | CCc1ccccc1CNC(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C17H26N2O2/c1-2-13-7-3-4-8-14(13)11-18-17(21)19-16-10-6-5-9-15(16)12-20/h3-4,7-8,15-16,20H,2,5-6,9-12H2,1H3,(H2,18,19,21) |
| InChIKey | NDBNMJPWMRZURD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |