C12H24N2O2 — CID 96569161
1-butyl-3-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]urea (PubChem CID 96569161) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-butyl-3-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]urea.
| Compound Name | 1-butyl-3-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 96569161 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-butyl-3-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]urea |
| SMILES | CCCCNC(=O)N[C@@H]1CCCC[C@@H]1CO |
| InChI | InChI=1S/C12H24N2O2/c1-2-3-8-13-12(16)14-11-7-5-4-6-10(11)9-15/h10-11,15H,2-9H2,1H3,(H2,13,14,16)/t10-,11-/m1/s1 |
| InChIKey | ZXOVYDUWRZQURM-GHMZBOCLSA-N |
| XLogP | 1.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|