C11H23N3O — CID 63258563
1-(2-aminocycloheptyl)-3-propylurea (PubChem CID 63258563) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(2-aminocycloheptyl)-3-propylurea.
| Compound Name | 1-(2-aminocycloheptyl)-3-propylurea |
|---|---|
| PubChem CID | 63258563 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1-(2-aminocycloheptyl)-3-propylurea |
| SMILES | CCCNC(=O)NC1CCCCCC1N |
| InChI | InChI=1S/C11H23N3O/c1-2-8-13-11(15)14-10-7-5-3-4-6-9(10)12/h9-10H,2-8,12H2,1H3,(H2,13,14,15) |
| InChIKey | OUXAKBYDSSRIGT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |