C13H14BrCl2NO — CID 113275038
N-(2-bromocyclohexyl)-2,6-dichlorobenzamide (PubChem CID 113275038) has the molecular formula C13H14BrCl2NO and a molecular weight of 351.07 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-2,6-dichlorobenzamide.
| Compound Name | N-(2-bromocyclohexyl)-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 113275038 |
| Molecular Formula | C13H14BrCl2NO |
| Molecular Weight | 351.07 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | N-(2-bromocyclohexyl)-2,6-dichlorobenzamide |
| SMILES | O=C(NC1CCCCC1Br)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H14BrCl2NO/c14-8-4-1-2-7-11(8)17-13(18)12-9(15)5-3-6-10(12)16/h3,5-6,8,11H,1-2,4,7H2,(H,17,18) |
| InChIKey | PMUUUVGXNUMCBC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.07 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|