C19H25ClN2O2 — CID 4834741
N-[3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-oxopropyl]-2-chlorobenzamide (PubChem CID 4834741) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is N-[3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-oxopropyl]-2-chlorobenzamide.
| Compound Name | N-[3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-oxopropyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 4834741 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-oxopropyl]-2-chlorobenzamide |
| SMILES | CC(NC(=O)CCNC(=O)c1ccccc1Cl)C1CC2CCC1C2 |
| InChI | InChI=1S/C19H25ClN2O2/c1-12(16-11-13-6-7-14(16)10-13)22-18(23)8-9-21-19(24)15-4-2-3-5-17(15)20/h2-5,12-14,16H,6-11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | PSPNGHVGPUORBC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |