C16H21NO2 — CID 98080564
phenyl N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamate (PubChem CID 98080564) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is phenyl N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamate.
| Compound Name | phenyl N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 98080564 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | phenyl N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)Oc1ccccc1)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C16H21NO2/c1-11(15-10-12-7-8-13(15)9-12)17-16(18)19-14-5-3-2-4-6-14/h2-6,11-13,15H,7-10H2,1H3,(H,17,18)/t11-,12+,13+,15-/m0/s1 |
| InChIKey | AAIVFUYGVXPNAU-JLNYLFASSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |