C18H24N2O2 — CID 108508984
N-benzyl-N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]oxamide (PubChem CID 108508984) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-benzyl-N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]oxamide.
| Compound Name | N-benzyl-N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108508984 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-benzyl-N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)NCc1ccccc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H24N2O2/c1-12(16-10-14-7-8-15(16)9-14)20-18(22)17(21)19-11-13-5-3-2-4-6-13/h2-6,12,14-16H,7-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | BWRQCRRMFJVFQD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|