C18H23NO — CID 98510446
(E)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-phenylprop-2-enamide (PubChem CID 98510446) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 98510446 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (E)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-phenylprop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccc1)[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C18H23NO/c1-13(17-12-15-7-9-16(17)11-15)19-18(20)10-8-14-5-3-2-4-6-14/h2-6,8,10,13,15-17H,7,9,11-12H2,1H3,(H,19,20)/b10-8+/t13-,15+,16+,17+/m0/s1 |
| InChIKey | XBXVJWLMSVDMJL-NEIWQKSPSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|