C21H28N2O3S — CID 129377387
(E)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide (PubChem CID 129377387) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is (E)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129377387 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C=C/c1ccc(N2CCCS2(=O)=O)cc1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C21H28N2O3S/c1-15(20-14-17-3-7-18(20)13-17)22-21(24)10-6-16-4-8-19(9-5-16)23-11-2-12-27(23,25)26/h4-6,8-10,15,17-18,20H,2-3,7,11-14H2,1H3,(H,22,24)/b10-6+/t15-,17+,18+,20+/m1/s1 |
| InChIKey | RXPANFLFCPAUQX-ILTQADSXSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|