C20H27NO — CID 124768104
(E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-ethylphenyl)prop-2-enamide (PubChem CID 124768104) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124768104 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(/C=C/C(=O)N[C@@H](C)[C@H]2C[C@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C20H27NO/c1-3-15-4-6-16(7-5-15)9-11-20(22)21-14(2)19-13-17-8-10-18(19)12-17/h4-7,9,11,14,17-19H,3,8,10,12-13H2,1-2H3,(H,21,22)/b11-9+/t14-,17-,18-,19+/m0/s1 |
| InChIKey | ACRRDIXUKNFNQM-JHRGTCGZSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|