C22H32F4N2O2 — CID 98271573
N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-N'-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,2,3,3-tetrafluorobutanediamide (PubChem CID 98271573) has the molecular formula C22H32F4N2O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-N'-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,2,3,3-tetrafluorobutanediamide.
| Compound Name | N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-N'-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,2,3,3-tetrafluorobutanediamide |
|---|---|
| PubChem CID | 98271573 |
| Molecular Formula | C22H32F4N2O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-N'-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,2,3,3-tetrafluorobutanediamide |
| SMILES | C[C@H](NC(=O)C(F)(F)C(F)(F)C(=O)N[C@H](C)[C@@H]1C[C@@H]2CC[C@@H]1C2)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C22H32F4N2O2/c1-11(17-9-13-3-5-15(17)7-13)27-19(29)21(23,24)22(25,26)20(30)28-12(2)18-10-14-4-6-16(18)8-14/h11-18H,3-10H2,1-2H3,(H,27,29)(H,28,30)/t11-,12+,13-,14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | CRSOEMNMWKABAN-ZRWQNVEXSA-N |
| XLogP | 4.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|