C26H42N2O2 — CID 98390836
1-N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]cyclohexane-1,4-dicarboxamide (PubChem CID 98390836) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is 1-N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 98390836 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 1-N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]cyclohexane-1,4-dicarboxamide |
| SMILES | C[C@H](NC(=O)C1CCC(C(=O)N[C@H](C)[C@H]2C[C@@H]3CC[C@@H]2C3)CC1)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C26H42N2O2/c1-15(23-13-17-3-5-21(23)11-17)27-25(29)19-7-9-20(10-8-19)26(30)28-16(2)24-14-18-4-6-22(24)12-18/h15-24H,3-14H2,1-2H3,(H,27,29)(H,28,30)/t15-,16+,17-,18-,19?,20?,21-,22-,23-,24+/m1/s1 |
| InChIKey | IOGFZBPTYATEIP-JZSZKFEKSA-N |
| XLogP | 4.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |