C24H40N2O2S — CID 100726421
N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[3-[[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-3-oxopropyl]sulfanylpropanamide (PubChem CID 100726421) has the molecular formula C24H40N2O2S and a molecular weight of 420.66 g/mol. Its IUPAC name is N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[3-[[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-3-oxopropyl]sulfanylpropanamide.
| Compound Name | N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[3-[[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-3-oxopropyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 100726421 |
| Molecular Formula | C24H40N2O2S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[3-[[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-3-oxopropyl]sulfanylpropanamide |
| SMILES | C[C@@H](NC(=O)CCSCCC(=O)N[C@H](C)[C@@H]1C[C@@H]2CC[C@@H]1C2)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C24H40N2O2S/c1-15(21-13-17-3-5-19(21)11-17)25-23(27)7-9-29-10-8-24(28)26-16(2)22-14-18-4-6-20(22)12-18/h15-22H,3-14H2,1-2H3,(H,25,27)(H,26,28)/t15-,16-,17-,18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | CNKGZCDPCYQDTL-FVJWFDNUSA-N |
| XLogP | 4.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|