C15H24NNaO3 — CID 154802194
sodium 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-6-oxohexanoate (PubChem CID 154802194) has the molecular formula C15H24NNaO3 and a molecular weight of 289.35 g/mol. Its IUPAC name is sodium 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-6-oxohexanoate.
| Compound Name | sodium 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 154802194 |
| Molecular Formula | C15H24NNaO3 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | sodium 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-6-oxohexanoate |
| SMILES | CC(NC(=O)CCCCC(=O)[O-])C1CC2CCC1C2.[Na+] |
| InChI | InChI=1S/C15H25NO3.Na/c1-10(13-9-11-6-7-12(13)8-11)16-14(17)4-2-3-5-15(18)19;/h10-13H,2-9H2,1H3,(H,16,17)(H,18,19);/q;+1/p-1 |
| InChIKey | SWRLGDFJEBGATB-UHFFFAOYSA-M |
| XLogP | -1.76 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|