C20H29N3O3S2 — CID 98288990
1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 98288990) has the molecular formula C20H29N3O3S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 98288990 |
| Molecular Formula | C20H29N3O3S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C20H29N3O3S2/c1-14(19-13-15-2-3-16(19)12-15)21-20(27)22-17-4-6-18(7-5-17)28(24,25)23-8-10-26-11-9-23/h4-7,14-16,19H,2-3,8-13H2,1H3,(H2,21,22,27)/t14-,15+,16+,19-/m1/s1 |
| InChIKey | HJDYPRWQFZPBIG-PASDCYSWSA-N |
| XLogP | 2.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|