C21H27NO3 — CID 87414752
(1R,2S,5R)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 87414752) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | (1R,2S,5R)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87414752 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (1R,2S,5R)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H]3C[C@H](C)CC[C@H]3C(C)C)ccc12 |
| InChI | InChI=1S/C21H27NO3/c1-12(2)16-7-5-13(3)9-18(16)21(24)22-15-6-8-17-14(4)10-20(23)25-19(17)11-15/h6,8,10-13,16,18H,5,7,9H2,1-4H3,(H,22,24)/t13-,16+,18-/m1/s1 |
| InChIKey | VZYIMCWADMSNKJ-RPVQJOFSSA-N |
| XLogP | 4.75 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|