C18H26ClNO2 — CID 66761959
N-(3-chloro-4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 66761959) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66761959 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(C)CCC2C(C)C)cc1Cl |
| InChI | InChI=1S/C18H26ClNO2/c1-11(2)14-7-5-12(3)9-15(14)18(21)20-13-6-8-17(22-4)16(19)10-13/h6,8,10-12,14-15H,5,7,9H2,1-4H3,(H,20,21) |
| InChIKey | WLSJMAAFTFNFTP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |