C28H26Cl2N4O2S — CID 23969396
1-[4-[4-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenylprop-2-yn-1-one (PubChem CID 23969396) has the molecular formula C28H26Cl2N4O2S and a molecular weight of 553.52 g/mol. Its IUPAC name is 1-[4-[4-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenylprop-2-yn-1-one.
| Compound Name | 1-[4-[4-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenylprop-2-yn-1-one |
|---|---|
| PubChem CID | 23969396 |
| Molecular Formula | C28H26Cl2N4O2S |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 1-[4-[4-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenylprop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccccc1)N1CCC(c2nc(C(=O)N3CCN(c4ccc(Cl)c(Cl)c4)CC3)cs2)CC1 |
| InChI | InChI=1S/C28H26Cl2N4O2S/c29-23-8-7-22(18-24(23)30)32-14-16-34(17-15-32)28(36)25-19-37-27(31-25)21-10-12-33(13-11-21)26(35)9-6-20-4-2-1-3-5-20/h1-5,7-8,18-19,21H,10-17H2 |
| InChIKey | ZZTLIEKTRFSEOE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|