C27H27N3O4S — CID 3861771
N-[(3,5-dimethoxyphenyl)methyl]-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3861771) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3861771 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(CNC(=O)c2csc(C3CCN(C(=O)C#Cc4ccccc4)CC3)n2)cc(OC)c1 |
| InChI | InChI=1S/C27H27N3O4S/c1-33-22-14-20(15-23(16-22)34-2)17-28-26(32)24-18-35-27(29-24)21-10-12-30(13-11-21)25(31)9-8-19-6-4-3-5-7-19/h3-7,14-16,18,21H,10-13,17H2,1-2H3,(H,28,32) |
| InChIKey | BZOQUNBOUQDNOE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|