C27H23N3O2S2 — CID 3818055
N-(1-benzothiophen-3-ylmethyl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3818055) has the molecular formula C27H23N3O2S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3818055 |
| Molecular Formula | C27H23N3O2S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1csc2ccccc12)c1csc(C2CCN(C(=O)C#Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C27H23N3O2S2/c31-25(11-10-19-6-2-1-3-7-19)30-14-12-20(13-15-30)27-29-23(18-34-27)26(32)28-16-21-17-33-24-9-5-4-8-22(21)24/h1-9,17-18,20H,12-16H2,(H,28,32) |
| InChIKey | YOIQXECECDYWGM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|