C21H32N4O3 — CID 87039625
N-[3-(3-methylpiperidin-1-yl)propyl]-N'-(3-morpholin-4-ylphenyl)oxamide (PubChem CID 87039625) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[3-(3-methylpiperidin-1-yl)propyl]-N'-(3-morpholin-4-ylphenyl)oxamide.
| Compound Name | N-[3-(3-methylpiperidin-1-yl)propyl]-N'-(3-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 87039625 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[3-(3-methylpiperidin-1-yl)propyl]-N'-(3-morpholin-4-ylphenyl)oxamide |
| SMILES | CC1CCCN(CCCNC(=O)C(=O)Nc2cccc(N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C21H32N4O3/c1-17-5-3-9-24(16-17)10-4-8-22-20(26)21(27)23-18-6-2-7-19(15-18)25-11-13-28-14-12-25/h2,6-7,15,17H,3-5,8-14,16H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | WYMSYJRQHUSPID-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|