C21H30N4O3 — CID 86996575
N'-[3-(cyclopropylcarbamoyl)phenyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxamide (PubChem CID 86996575) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N'-[3-(cyclopropylcarbamoyl)phenyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxamide.
| Compound Name | N'-[3-(cyclopropylcarbamoyl)phenyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 86996575 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N'-[3-(cyclopropylcarbamoyl)phenyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxamide |
| SMILES | CC1CCN(CCCNC(=O)C(=O)Nc2cccc(C(=O)NC3CC3)c2)CC1 |
| InChI | InChI=1S/C21H30N4O3/c1-15-8-12-25(13-9-15)11-3-10-22-20(27)21(28)24-18-5-2-4-16(14-18)19(26)23-17-6-7-17/h2,4-5,14-15,17H,3,6-13H2,1H3,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | GRFJUNCKEXPLFN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|