C19H28N2O2 — CID 134057675
3-(2,2-dimethylpropanoylamino)-N-(4-methylcyclohexyl)benzamide (PubChem CID 134057675) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 3-(2,2-dimethylpropanoylamino)-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 134057675 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)-N-(4-methylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-13-8-10-15(11-9-13)20-17(22)14-6-5-7-16(12-14)21-18(23)19(2,3)4/h5-7,12-13,15H,8-11H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | BZJAZCCMONDVTB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |