C18H26N2O2 — CID 17170559
N-cyclohexyl-3-(2,2-dimethylpropanoylamino)benzamide (PubChem CID 17170559) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-cyclohexyl-3-(2,2-dimethylpropanoylamino)benzamide.
| Compound Name | N-cyclohexyl-3-(2,2-dimethylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 17170559 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-cyclohexyl-3-(2,2-dimethylpropanoylamino)benzamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C18H26N2O2/c1-18(2,3)17(22)20-15-11-7-8-13(12-15)16(21)19-14-9-5-4-6-10-14/h7-8,11-12,14H,4-6,9-10H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | TYPUKBQUWIJEAP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |