C19H28N2O2 — CID 109055977
3-N-tert-butyl-1-N-cycloheptylbenzene-1,3-dicarboxamide (PubChem CID 109055977) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-N-tert-butyl-1-N-cycloheptylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-tert-butyl-1-N-cycloheptylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055977 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-N-tert-butyl-1-N-cycloheptylbenzene-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-19(2,3)21-18(23)15-10-8-9-14(13-15)17(22)20-16-11-6-4-5-7-12-16/h8-10,13,16H,4-7,11-12H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | SUVYJAOFGBXLQD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |