C14H19NO — CID 59732225
3-tert-butyl-N-cyclopropylbenzamide (PubChem CID 59732225) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-tert-butyl-N-cyclopropylbenzamide.
| Compound Name | 3-tert-butyl-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 59732225 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-tert-butyl-N-cyclopropylbenzamide |
| SMILES | CC(C)(C)c1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C14H19NO/c1-14(2,3)11-6-4-5-10(9-11)13(16)15-12-7-8-12/h4-6,9,12H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | ATTAGLOFHSJHTI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |