C19H26N2O5S — CID 16501649
[2-oxo-2-(prop-2-enylamino)ethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 16501649) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16501649 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc(S(=O)(=O)N2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C19H26N2O5S/c1-4-9-20-18(22)13-26-19(23)16-5-7-17(8-6-16)27(24,25)21-11-14(2)10-15(3)12-21/h4-8,14-15H,1,9-13H2,2-3H3,(H,20,22) |
| InChIKey | LRILADQUOXLJSS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|