C22H24ClN3O7S — CID 26916479
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 26916479) has the molecular formula C22H24ClN3O7S and a molecular weight of 509.97 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 26916479 |
| Molecular Formula | C22H24ClN3O7S |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(C(=O)OCC(=O)Nc3cc([N+](=O)[O-])ccc3Cl)cc2)C1 |
| InChI | InChI=1S/C22H24ClN3O7S/c1-14-9-15(2)12-25(11-14)34(31,32)18-6-3-16(4-7-18)22(28)33-13-21(27)24-20-10-17(26(29)30)5-8-19(20)23/h3-8,10,14-15H,9,11-13H2,1-2H3,(H,24,27)/t14-,15-/m0/s1 |
| InChIKey | RZOBKHHNQUWQDU-GJZGRUSLSA-N |
| XLogP | 3.71 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|